C16H17NO4 — CID 102417431
prop-2-enyl (2S)-2-(2,5-dioxopyrrolidin-1-yl)-3-phenylpropanoate (PubChem CID 102417431) has the molecular formula C16H17NO4 and a molecular weight of 287.32 g/mol. Its IUPAC name is prop-2-enyl (2S)-2-(2,5-dioxopyrrolidin-1-yl)-3-phenylpropanoate.
| Compound Name | prop-2-enyl (2S)-2-(2,5-dioxopyrrolidin-1-yl)-3-phenylpropanoate |
|---|---|
| PubChem CID | 102417431 |
| Molecular Formula | C16H17NO4 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | prop-2-enyl (2S)-2-(2,5-dioxopyrrolidin-1-yl)-3-phenylpropanoate |
| SMILES | C=CCOC(=O)[C@H](Cc1ccccc1)N1C(=O)CCC1=O |
| InChI | InChI=1S/C16H17NO4/c1-2-10-21-16(20)13(11-12-6-4-3-5-7-12)17-14(18)8-9-15(17)19/h2-7,13H,1,8-11H2/t13-/m0/s1 |
| InChIKey | YPPWJMYWVAYXEG-ZDUSSCGKSA-N |
| XLogP | 1.48 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|