C15H21NO2 — CID 59197617
prop-2-enyl (2S,4R)-4-amino-2-methyl-5-phenylpentanoate (PubChem CID 59197617) has the molecular formula C15H21NO2 and a molecular weight of 247.34 g/mol. Its IUPAC name is prop-2-enyl (2S,4R)-4-amino-2-methyl-5-phenylpentanoate.
| Compound Name | prop-2-enyl (2S,4R)-4-amino-2-methyl-5-phenylpentanoate |
|---|---|
| PubChem CID | 59197617 |
| Molecular Formula | C15H21NO2 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | prop-2-enyl (2S,4R)-4-amino-2-methyl-5-phenylpentanoate |
| SMILES | C=CCOC(=O)[C@@H](C)C[C@@H](N)Cc1ccccc1 |
| InChI | InChI=1S/C15H21NO2/c1-3-9-18-15(17)12(2)10-14(16)11-13-7-5-4-6-8-13/h3-8,12,14H,1,9-11,16H2,2H3/t12-,14+/m0/s1 |
| InChIKey | OOVYAQHLOHVCSB-GXTWGEPZSA-N |
| XLogP | 2.31 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|