C25H35N3O3S — CID 132917776
prop-2-enyl (2S,4R)-4-[[2-[(3R)-3-amino-4-methylpentyl]-1,3-thiazole-4-carbonyl]amino]-2-methyl-5-phenylpentanoate (PubChem CID 132917776) has the molecular formula C25H35N3O3S and a molecular weight of 457.64 g/mol. Its IUPAC name is prop-2-enyl (2S,4R)-4-[[2-[(3R)-3-amino-4-methylpentyl]-1,3-thiazole-4-carbonyl]amino]-2-methyl-5-phenylpentanoate.
| Compound Name | prop-2-enyl (2S,4R)-4-[[2-[(3R)-3-amino-4-methylpentyl]-1,3-thiazole-4-carbonyl]amino]-2-methyl-5-phenylpentanoate |
|---|---|
| PubChem CID | 132917776 |
| Molecular Formula | C25H35N3O3S |
| Molecular Weight | 457.64 g/mol |
| Exact Mass | 457.24 |
| IUPAC Name | prop-2-enyl (2S,4R)-4-[[2-[(3R)-3-amino-4-methylpentyl]-1,3-thiazole-4-carbonyl]amino]-2-methyl-5-phenylpentanoate |
| SMILES | C=CCOC(=O)[C@@H](C)C[C@H](Cc1ccccc1)NC(=O)c1csc(CC[C@@H](N)C(C)C)n1 |
| InChI | InChI=1S/C25H35N3O3S/c1-5-13-31-25(30)18(4)14-20(15-19-9-7-6-8-10-19)27-24(29)22-16-32-23(28-22)12-11-21(26)17(2)3/h5-10,16-18,20-21H,1,11-15,26H2,2-4H3,(H,27,29)/t18-,20+,21+/m0/s1 |
| InChIKey | HRDRIGGADMMAAQ-CEWLAPEOSA-N |
| XLogP | 4.16 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.64 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|