C18H22ClNO3 — CID 122454136
(2R,4S)-4-amino-2-methyl-5-(4-phenylphenyl)pentanoic acid;hypochlorous acid (PubChem CID 122454136) has the molecular formula C18H22ClNO3 and a molecular weight of 335.83 g/mol. Its IUPAC name is (2R,4S)-4-amino-2-methyl-5-(4-phenylphenyl)pentanoic acid;hypochlorous acid.
| Compound Name | (2R,4S)-4-amino-2-methyl-5-(4-phenylphenyl)pentanoic acid;hypochlorous acid |
|---|---|
| PubChem CID | 122454136 |
| Molecular Formula | C18H22ClNO3 |
| Molecular Weight | 335.83 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | (2R,4S)-4-amino-2-methyl-5-(4-phenylphenyl)pentanoic acid;hypochlorous acid |
| SMILES | C[C@H](C[C@H](N)Cc1ccc(-c2ccccc2)cc1)C(=O)O.OCl |
| InChI | InChI=1S/C18H21NO2.ClHO/c1-13(18(20)21)11-17(19)12-14-7-9-16(10-8-14)15-5-3-2-4-6-15;1-2/h2-10,13,17H,11-12,19H2,1H3,(H,20,21);2H/t13-,17+;/m1./s1 |
| InChIKey | YSLCYHQURRXRPD-YNDBEVAQSA-N |
| XLogP | 3.47 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.83 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |