C17H18ClNO3 — CID 123714771
4-amino-5-[4-(3-chlorophenyl)phenyl]-2-hydroxypentanoic acid (PubChem CID 123714771) has the molecular formula C17H18ClNO3 and a molecular weight of 319.79 g/mol. Its IUPAC name is 4-amino-5-[4-(3-chlorophenyl)phenyl]-2-hydroxypentanoic acid.
| Compound Name | 4-amino-5-[4-(3-chlorophenyl)phenyl]-2-hydroxypentanoic acid |
|---|---|
| PubChem CID | 123714771 |
| Molecular Formula | C17H18ClNO3 |
| Molecular Weight | 319.79 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | 4-amino-5-[4-(3-chlorophenyl)phenyl]-2-hydroxypentanoic acid |
| SMILES | NC(Cc1ccc(-c2cccc(Cl)c2)cc1)CC(O)C(=O)O |
| InChI | InChI=1S/C17H18ClNO3/c18-14-3-1-2-13(9-14)12-6-4-11(5-7-12)8-15(19)10-16(20)17(21)22/h1-7,9,15-16,20H,8,10,19H2,(H,21,22) |
| InChIKey | BVFPYVYHLIBVCM-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.79 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |