C20H19ClF5NO3 — CID 86705141
2,2,3,3,3-pentafluoropropyl (2R,4R)-4-amino-5-[4-(3-chlorophenyl)phenyl]-2-hydroxypentanoate (PubChem CID 86705141) has the molecular formula C20H19ClF5NO3 and a molecular weight of 451.82 g/mol. Its IUPAC name is 2,2,3,3,3-pentafluoropropyl (2R,4R)-4-amino-5-[4-(3-chlorophenyl)phenyl]-2-hydroxypentanoate.
| Compound Name | 2,2,3,3,3-pentafluoropropyl (2R,4R)-4-amino-5-[4-(3-chlorophenyl)phenyl]-2-hydroxypentanoate |
|---|---|
| PubChem CID | 86705141 |
| Molecular Formula | C20H19ClF5NO3 |
| Molecular Weight | 451.82 g/mol |
| Exact Mass | 451.10 |
| IUPAC Name | 2,2,3,3,3-pentafluoropropyl (2R,4R)-4-amino-5-[4-(3-chlorophenyl)phenyl]-2-hydroxypentanoate |
| SMILES | N[C@H](Cc1ccc(-c2cccc(Cl)c2)cc1)C[C@@H](O)C(=O)OCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C20H19ClF5NO3/c21-15-3-1-2-14(9-15)13-6-4-12(5-7-13)8-16(27)10-17(28)18(29)30-11-19(22,23)20(24,25)26/h1-7,9,16-17,28H,8,10-11,27H2/t16-,17-/m1/s1 |
| InChIKey | GIKWTUSZLQVCBQ-IAGOWNOFSA-N |
| XLogP | 4.37 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.82 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|