C21H24ClNO6 — CID 129017032
ethoxycarbonyloxymethyl (4R)-4-amino-5-[4-(3-chlorophenyl)phenyl]-2-hydroxypentanoate (PubChem CID 129017032) has the molecular formula C21H24ClNO6 and a molecular weight of 421.88 g/mol. Its IUPAC name is ethoxycarbonyloxymethyl (4R)-4-amino-5-[4-(3-chlorophenyl)phenyl]-2-hydroxypentanoate.
| Compound Name | ethoxycarbonyloxymethyl (4R)-4-amino-5-[4-(3-chlorophenyl)phenyl]-2-hydroxypentanoate |
|---|---|
| PubChem CID | 129017032 |
| Molecular Formula | C21H24ClNO6 |
| Molecular Weight | 421.88 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | ethoxycarbonyloxymethyl (4R)-4-amino-5-[4-(3-chlorophenyl)phenyl]-2-hydroxypentanoate |
| SMILES | CCOC(=O)OCOC(=O)C(O)C[C@H](N)Cc1ccc(-c2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C21H24ClNO6/c1-2-27-21(26)29-13-28-20(25)19(24)12-18(23)10-14-6-8-15(9-7-14)16-4-3-5-17(22)11-16/h3-9,11,18-19,24H,2,10,12-13,23H2,1H3/t18-,19?/m1/s1 |
| InChIKey | CKYZFKBSENMPPR-MRTLOADZSA-N |
| XLogP | 3.30 |
| TPSA | 108.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.88 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|