C13H18BrNO3 — CID 126659714
ethyl (4R)-4-amino-5-(4-bromophenyl)-2-hydroxypentanoate (PubChem CID 126659714) has the molecular formula C13H18BrNO3 and a molecular weight of 316.20 g/mol. Its IUPAC name is ethyl (4R)-4-amino-5-(4-bromophenyl)-2-hydroxypentanoate.
| Compound Name | ethyl (4R)-4-amino-5-(4-bromophenyl)-2-hydroxypentanoate |
|---|---|
| PubChem CID | 126659714 |
| Molecular Formula | C13H18BrNO3 |
| Molecular Weight | 316.20 g/mol |
| Exact Mass | 315.05 |
| IUPAC Name | ethyl (4R)-4-amino-5-(4-bromophenyl)-2-hydroxypentanoate |
| SMILES | CCOC(=O)C(O)C[C@H](N)Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C13H18BrNO3/c1-2-18-13(17)12(16)8-11(15)7-9-3-5-10(14)6-4-9/h3-6,11-12,16H,2,7-8,15H2,1H3/t11-,12?/m1/s1 |
| InChIKey | POWBJMDUYFKTRJ-JHJMLUEUSA-N |
| XLogP | 1.63 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.20 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |