C13H17BrClNO3 — CID 126659777
ethyl (4R)-4-amino-5-(4-bromo-2-chlorophenyl)-2-hydroxypentanoate (PubChem CID 126659777) has the molecular formula C13H17BrClNO3 and a molecular weight of 350.64 g/mol. Its IUPAC name is ethyl (4R)-4-amino-5-(4-bromo-2-chlorophenyl)-2-hydroxypentanoate.
| Compound Name | ethyl (4R)-4-amino-5-(4-bromo-2-chlorophenyl)-2-hydroxypentanoate |
|---|---|
| PubChem CID | 126659777 |
| Molecular Formula | C13H17BrClNO3 |
| Molecular Weight | 350.64 g/mol |
| Exact Mass | 349.01 |
| IUPAC Name | ethyl (4R)-4-amino-5-(4-bromo-2-chlorophenyl)-2-hydroxypentanoate |
| SMILES | CCOC(=O)C(O)C[C@H](N)Cc1ccc(Br)cc1Cl |
| InChI | InChI=1S/C13H17BrClNO3/c1-2-19-13(18)12(17)7-10(16)5-8-3-4-9(14)6-11(8)15/h3-4,6,10,12,17H,2,5,7,16H2,1H3/t10-,12?/m1/s1 |
| InChIKey | PGMNCBYFDMJAAJ-RWANSRKNSA-N |
| XLogP | 2.29 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.64 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |