C13H15BrClNO4 — CID 135215437
ethyl (2R,4R)-4-amino-5-(4-bromo-2-chlorophenyl)-2-hydroxy-3-oxopentanoate (PubChem CID 135215437) has the molecular formula C13H15BrClNO4 and a molecular weight of 364.62 g/mol. Its IUPAC name is ethyl (2R,4R)-4-amino-5-(4-bromo-2-chlorophenyl)-2-hydroxy-3-oxopentanoate.
| Compound Name | ethyl (2R,4R)-4-amino-5-(4-bromo-2-chlorophenyl)-2-hydroxy-3-oxopentanoate |
|---|---|
| PubChem CID | 135215437 |
| Molecular Formula | C13H15BrClNO4 |
| Molecular Weight | 364.62 g/mol |
| Exact Mass | 362.99 |
| IUPAC Name | ethyl (2R,4R)-4-amino-5-(4-bromo-2-chlorophenyl)-2-hydroxy-3-oxopentanoate |
| SMILES | CCOC(=O)[C@H](O)C(=O)[C@H](N)Cc1ccc(Br)cc1Cl |
| InChI | InChI=1S/C13H15BrClNO4/c1-2-20-13(19)12(18)11(17)10(16)5-7-3-4-8(14)6-9(7)15/h3-4,6,10,12,18H,2,5,16H2,1H3/t10-,12-/m1/s1 |
| InChIKey | GZLPKUHVZXCYMN-ZYHUDNBSSA-N |
| XLogP | 1.47 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.62 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|