C19H22ClNO3 — CID 90399401
ethyl (4R)-4-amino-5-[4-(3-chlorophenyl)phenyl]-2-hydroxypentanoate (PubChem CID 90399401) has the molecular formula C19H22ClNO3 and a molecular weight of 347.84 g/mol. Its IUPAC name is ethyl (4R)-4-amino-5-[4-(3-chlorophenyl)phenyl]-2-hydroxypentanoate.
| Compound Name | ethyl (4R)-4-amino-5-[4-(3-chlorophenyl)phenyl]-2-hydroxypentanoate |
|---|---|
| PubChem CID | 90399401 |
| Molecular Formula | C19H22ClNO3 |
| Molecular Weight | 347.84 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | ethyl (4R)-4-amino-5-[4-(3-chlorophenyl)phenyl]-2-hydroxypentanoate |
| SMILES | CCOC(=O)C(O)C[C@H](N)Cc1ccc(-c2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C19H22ClNO3/c1-2-24-19(23)18(22)12-17(21)10-13-6-8-14(9-7-13)15-4-3-5-16(20)11-15/h3-9,11,17-18,22H,2,10,12,21H2,1H3/t17-,18?/m1/s1 |
| InChIKey | HUXUEVMMHYSCFT-QNSVNVJESA-N |
| XLogP | 3.19 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.84 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |