C20H22ClNO5 — CID 123806863
acetyloxymethyl 4-amino-5-[4-(3-chlorophenyl)phenyl]-2-hydroxypentanoate (PubChem CID 123806863) has the molecular formula C20H22ClNO5 and a molecular weight of 391.85 g/mol. Its IUPAC name is acetyloxymethyl 4-amino-5-[4-(3-chlorophenyl)phenyl]-2-hydroxypentanoate.
| Compound Name | acetyloxymethyl 4-amino-5-[4-(3-chlorophenyl)phenyl]-2-hydroxypentanoate |
|---|---|
| PubChem CID | 123806863 |
| Molecular Formula | C20H22ClNO5 |
| Molecular Weight | 391.85 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | acetyloxymethyl 4-amino-5-[4-(3-chlorophenyl)phenyl]-2-hydroxypentanoate |
| SMILES | CC(=O)OCOC(=O)C(O)CC(N)Cc1ccc(-c2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C20H22ClNO5/c1-13(23)26-12-27-20(25)19(24)11-18(22)9-14-5-7-15(8-6-14)16-3-2-4-17(21)10-16/h2-8,10,18-19,24H,9,11-12,22H2,1H3 |
| InChIKey | SCPYOGZKDREWEN-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 98.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.85 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|