C30H28ClFN2O7 — CID 148629232
acetyloxymethyl (2R,4R)-4-[[4-amino-4-(2-fluorophenyl)-2-oxobut-3-enoyl]amino]-5-[4-(3-chlorophenyl)phenyl]-2-hydroxypentanoate (PubChem CID 148629232) has the molecular formula C30H28ClFN2O7 and a molecular weight of 583.01 g/mol. Its IUPAC name is acetyloxymethyl (2R,4R)-4-[[4-amino-4-(2-fluorophenyl)-2-oxobut-3-enoyl]amino]-5-[4-(3-chlorophenyl)phenyl]-2-hydroxypentanoate.
| Compound Name | acetyloxymethyl (2R,4R)-4-[[4-amino-4-(2-fluorophenyl)-2-oxobut-3-enoyl]amino]-5-[4-(3-chlorophenyl)phenyl]-2-hydroxypentanoate |
|---|---|
| PubChem CID | 148629232 |
| Molecular Formula | C30H28ClFN2O7 |
| Molecular Weight | 583.01 g/mol |
| Exact Mass | 582.16 |
| IUPAC Name | acetyloxymethyl (2R,4R)-4-[[4-amino-4-(2-fluorophenyl)-2-oxobut-3-enoyl]amino]-5-[4-(3-chlorophenyl)phenyl]-2-hydroxypentanoate |
| SMILES | CC(=O)OCOC(=O)[C@H](O)C[C@@H](Cc1ccc(-c2cccc(Cl)c2)cc1)NC(=O)C(=O)C=C(N)c1ccccc1F |
| InChI | InChI=1S/C30H28ClFN2O7/c1-18(35)40-17-41-30(39)28(37)15-23(13-19-9-11-20(12-10-19)21-5-4-6-22(31)14-21)34-29(38)27(36)16-26(33)24-7-2-3-8-25(24)32/h2-12,14,16,23,28,37H,13,15,17,33H2,1H3,(H,34,38)/t23-,28-/m1/s1 |
| InChIKey | XPWHSVADQWRUMW-QDPGVEIFSA-N |
| XLogP | 3.56 |
| TPSA | 145.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.01 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|