C22H24ClNO6 — CID 126659728
2-[[(2R)-1-[4-(3-chlorophenyl)phenyl]-4-hydroxy-5-oxo-5-propan-2-yloxypentan-2-yl]amino]-2-oxoacetic acid (PubChem CID 126659728) has the molecular formula C22H24ClNO6 and a molecular weight of 433.89 g/mol. Its IUPAC name is 2-[[(2R)-1-[4-(3-chlorophenyl)phenyl]-4-hydroxy-5-oxo-5-propan-2-yloxypentan-2-yl]amino]-2-oxoacetic acid.
| Compound Name | 2-[[(2R)-1-[4-(3-chlorophenyl)phenyl]-4-hydroxy-5-oxo-5-propan-2-yloxypentan-2-yl]amino]-2-oxoacetic acid |
|---|---|
| PubChem CID | 126659728 |
| Molecular Formula | C22H24ClNO6 |
| Molecular Weight | 433.89 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | 2-[[(2R)-1-[4-(3-chlorophenyl)phenyl]-4-hydroxy-5-oxo-5-propan-2-yloxypentan-2-yl]amino]-2-oxoacetic acid |
| SMILES | CC(C)OC(=O)C(O)C[C@@H](Cc1ccc(-c2cccc(Cl)c2)cc1)NC(=O)C(=O)O |
| InChI | InChI=1S/C22H24ClNO6/c1-13(2)30-22(29)19(25)12-18(24-20(26)21(27)28)10-14-6-8-15(9-7-14)16-4-3-5-17(23)11-16/h3-9,11,13,18-19,25H,10,12H2,1-2H3,(H,24,26)(H,27,28)/t18-,19?/m1/s1 |
| InChIKey | HXSOGWMGAAJSIY-MRTLOADZSA-N |
| XLogP | 2.82 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.89 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|