C20H19Cl2NO6 — CID 155903303
2-[[1-[3-chloro-4-(3-chlorophenyl)phenyl]-4-hydroxy-5-methoxy-5-oxopentan-2-yl]amino]-2-oxoacetic acid (PubChem CID 155903303) has the molecular formula C20H19Cl2NO6 and a molecular weight of 440.28 g/mol. Its IUPAC name is 2-[[1-[3-chloro-4-(3-chlorophenyl)phenyl]-4-hydroxy-5-methoxy-5-oxopentan-2-yl]amino]-2-oxoacetic acid.
| Compound Name | 2-[[1-[3-chloro-4-(3-chlorophenyl)phenyl]-4-hydroxy-5-methoxy-5-oxopentan-2-yl]amino]-2-oxoacetic acid |
|---|---|
| PubChem CID | 155903303 |
| Molecular Formula | C20H19Cl2NO6 |
| Molecular Weight | 440.28 g/mol |
| Exact Mass | 439.06 |
| IUPAC Name | 2-[[1-[3-chloro-4-(3-chlorophenyl)phenyl]-4-hydroxy-5-methoxy-5-oxopentan-2-yl]amino]-2-oxoacetic acid |
| SMILES | COC(=O)C(O)CC(Cc1ccc(-c2cccc(Cl)c2)c(Cl)c1)NC(=O)C(=O)O |
| InChI | InChI=1S/C20H19Cl2NO6/c1-29-20(28)17(24)10-14(23-18(25)19(26)27)7-11-5-6-15(16(22)8-11)12-3-2-4-13(21)9-12/h2-6,8-9,14,17,24H,7,10H2,1H3,(H,23,25)(H,26,27) |
| InChIKey | YDUJJIGBDCBLEO-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.28 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|