C24H22ClN3O5 — CID 90386915
(2R,4R)-5-[4-(3-chlorophenyl)phenyl]-2-hydroxy-4-[[2-oxo-2-(pyridin-4-ylamino)acetyl]amino]pentanoic acid (PubChem CID 90386915) has the molecular formula C24H22ClN3O5 and a molecular weight of 467.91 g/mol. Its IUPAC name is (2R,4R)-5-[4-(3-chlorophenyl)phenyl]-2-hydroxy-4-[[2-oxo-2-(pyridin-4-ylamino)acetyl]amino]pentanoic acid.
| Compound Name | (2R,4R)-5-[4-(3-chlorophenyl)phenyl]-2-hydroxy-4-[[2-oxo-2-(pyridin-4-ylamino)acetyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 90386915 |
| Molecular Formula | C24H22ClN3O5 |
| Molecular Weight | 467.91 g/mol |
| Exact Mass | 467.12 |
| IUPAC Name | (2R,4R)-5-[4-(3-chlorophenyl)phenyl]-2-hydroxy-4-[[2-oxo-2-(pyridin-4-ylamino)acetyl]amino]pentanoic acid |
| SMILES | O=C(Nc1ccncc1)C(=O)N[C@H](Cc1ccc(-c2cccc(Cl)c2)cc1)C[C@@H](O)C(=O)O |
| InChI | InChI=1S/C24H22ClN3O5/c25-18-3-1-2-17(13-18)16-6-4-15(5-7-16)12-20(14-21(29)24(32)33)28-23(31)22(30)27-19-8-10-26-11-9-19/h1-11,13,20-21,29H,12,14H2,(H,28,31)(H,32,33)(H,26,27,30)/t20-,21-/m1/s1 |
| InChIKey | ZBKAMTPSVRABDM-NHCUHLMSSA-N |
| XLogP | 2.90 |
| TPSA | 128.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.91 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|