C25H23ClFN3O5 — CID 90387557
(2R,4R)-5-[4-(3-chlorophenyl)phenyl]-4-[[2-[2-(2-fluorophenyl)hydrazinyl]-2-oxoacetyl]amino]-2-hydroxypentanoic acid (PubChem CID 90387557) has the molecular formula C25H23ClFN3O5 and a molecular weight of 499.93 g/mol. Its IUPAC name is (2R,4R)-5-[4-(3-chlorophenyl)phenyl]-4-[[2-[2-(2-fluorophenyl)hydrazinyl]-2-oxoacetyl]amino]-2-hydroxypentanoic acid.
| Compound Name | (2R,4R)-5-[4-(3-chlorophenyl)phenyl]-4-[[2-[2-(2-fluorophenyl)hydrazinyl]-2-oxoacetyl]amino]-2-hydroxypentanoic acid |
|---|---|
| PubChem CID | 90387557 |
| Molecular Formula | C25H23ClFN3O5 |
| Molecular Weight | 499.93 g/mol |
| Exact Mass | 499.13 |
| IUPAC Name | (2R,4R)-5-[4-(3-chlorophenyl)phenyl]-4-[[2-[2-(2-fluorophenyl)hydrazinyl]-2-oxoacetyl]amino]-2-hydroxypentanoic acid |
| SMILES | O=C(NNc1ccccc1F)C(=O)N[C@H](Cc1ccc(-c2cccc(Cl)c2)cc1)C[C@@H](O)C(=O)O |
| InChI | InChI=1S/C25H23ClFN3O5/c26-18-5-3-4-17(13-18)16-10-8-15(9-11-16)12-19(14-22(31)25(34)35)28-23(32)24(33)30-29-21-7-2-1-6-20(21)27/h1-11,13,19,22,29,31H,12,14H2,(H,28,32)(H,30,33)(H,34,35)/t19-,22-/m1/s1 |
| InChIKey | RCTKYMINHKLRFV-DENIHFKCSA-N |
| XLogP | 3.15 |
| TPSA | 127.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.93 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|