C21H19ClF3NO6 — CID 126659735
2-[[(2R)-1-[4-(3-chlorophenyl)phenyl]-4-hydroxy-5-oxo-5-(2,2,2-trifluoroethoxy)pentan-2-yl]amino]-2-oxoacetic acid (PubChem CID 126659735) has the molecular formula C21H19ClF3NO6 and a molecular weight of 473.83 g/mol. Its IUPAC name is 2-[[(2R)-1-[4-(3-chlorophenyl)phenyl]-4-hydroxy-5-oxo-5-(2,2,2-trifluoroethoxy)pentan-2-yl]amino]-2-oxoacetic acid.
| Compound Name | 2-[[(2R)-1-[4-(3-chlorophenyl)phenyl]-4-hydroxy-5-oxo-5-(2,2,2-trifluoroethoxy)pentan-2-yl]amino]-2-oxoacetic acid |
|---|---|
| PubChem CID | 126659735 |
| Molecular Formula | C21H19ClF3NO6 |
| Molecular Weight | 473.83 g/mol |
| Exact Mass | 473.09 |
| IUPAC Name | 2-[[(2R)-1-[4-(3-chlorophenyl)phenyl]-4-hydroxy-5-oxo-5-(2,2,2-trifluoroethoxy)pentan-2-yl]amino]-2-oxoacetic acid |
| SMILES | O=C(O)C(=O)N[C@H](Cc1ccc(-c2cccc(Cl)c2)cc1)CC(O)C(=O)OCC(F)(F)F |
| InChI | InChI=1S/C21H19ClF3NO6/c22-15-3-1-2-14(9-15)13-6-4-12(5-7-13)8-16(26-18(28)19(29)30)10-17(27)20(31)32-11-21(23,24)25/h1-7,9,16-17,27H,8,10-11H2,(H,26,28)(H,29,30)/t16-,17?/m1/s1 |
| InChIKey | VXQQWYPVFCULNK-TZHYSIJRSA-N |
| XLogP | 2.98 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.83 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|