C23H28ClN3O5 — CID 90389414
5-[4-(3-chlorophenyl)phenyl]-2-hydroxy-4-[[2-[2-(2-methylpropyl)hydrazinyl]-2-oxoacetyl]amino]pentanoic acid (PubChem CID 90389414) has the molecular formula C23H28ClN3O5 and a molecular weight of 461.95 g/mol. Its IUPAC name is 5-[4-(3-chlorophenyl)phenyl]-2-hydroxy-4-[[2-[2-(2-methylpropyl)hydrazinyl]-2-oxoacetyl]amino]pentanoic acid.
| Compound Name | 5-[4-(3-chlorophenyl)phenyl]-2-hydroxy-4-[[2-[2-(2-methylpropyl)hydrazinyl]-2-oxoacetyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 90389414 |
| Molecular Formula | C23H28ClN3O5 |
| Molecular Weight | 461.95 g/mol |
| Exact Mass | 461.17 |
| IUPAC Name | 5-[4-(3-chlorophenyl)phenyl]-2-hydroxy-4-[[2-[2-(2-methylpropyl)hydrazinyl]-2-oxoacetyl]amino]pentanoic acid |
| SMILES | CC(C)CNNC(=O)C(=O)NC(Cc1ccc(-c2cccc(Cl)c2)cc1)CC(O)C(=O)O |
| InChI | InChI=1S/C23H28ClN3O5/c1-14(2)13-25-27-22(30)21(29)26-19(12-20(28)23(31)32)10-15-6-8-16(9-7-15)17-4-3-5-18(24)11-17/h3-9,11,14,19-20,25,28H,10,12-13H2,1-2H3,(H,26,29)(H,27,30)(H,31,32) |
| InChIKey | ZOUDWTZYGGEDDS-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 127.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.95 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|