C23H26ClN3O6 — CID 78320183
5-[4-(3-chlorophenyl)phenyl]-2-hydroxy-4-[[2-(morpholin-4-ylamino)-2-oxoacetyl]amino]pentanoic acid (PubChem CID 78320183) has the molecular formula C23H26ClN3O6 and a molecular weight of 475.93 g/mol. Its IUPAC name is 5-[4-(3-chlorophenyl)phenyl]-2-hydroxy-4-[[2-(morpholin-4-ylamino)-2-oxoacetyl]amino]pentanoic acid.
| Compound Name | 5-[4-(3-chlorophenyl)phenyl]-2-hydroxy-4-[[2-(morpholin-4-ylamino)-2-oxoacetyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 78320183 |
| Molecular Formula | C23H26ClN3O6 |
| Molecular Weight | 475.93 g/mol |
| Exact Mass | 475.15 |
| IUPAC Name | 5-[4-(3-chlorophenyl)phenyl]-2-hydroxy-4-[[2-(morpholin-4-ylamino)-2-oxoacetyl]amino]pentanoic acid |
| SMILES | O=C(NC(Cc1ccc(-c2cccc(Cl)c2)cc1)CC(O)C(=O)O)C(=O)NN1CCOCC1 |
| InChI | InChI=1S/C23H26ClN3O6/c24-18-3-1-2-17(13-18)16-6-4-15(5-7-16)12-19(14-20(28)23(31)32)25-21(29)22(30)26-27-8-10-33-11-9-27/h1-7,13,19-20,28H,8-12,14H2,(H,25,29)(H,26,30)(H,31,32) |
| InChIKey | YAIQYMOGZVMHEH-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 128.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.93 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|