C28H28ClN3O7 — CID 90389465
5-[4-(3-chlorophenyl)phenyl]-4-[[2-[4-(furan-2-carbonyl)piperazin-1-yl]-2-oxoacetyl]amino]-2-hydroxypentanoic acid (PubChem CID 90389465) has the molecular formula C28H28ClN3O7 and a molecular weight of 554.00 g/mol. Its IUPAC name is 5-[4-(3-chlorophenyl)phenyl]-4-[[2-[4-(furan-2-carbonyl)piperazin-1-yl]-2-oxoacetyl]amino]-2-hydroxypentanoic acid.
| Compound Name | 5-[4-(3-chlorophenyl)phenyl]-4-[[2-[4-(furan-2-carbonyl)piperazin-1-yl]-2-oxoacetyl]amino]-2-hydroxypentanoic acid |
|---|---|
| PubChem CID | 90389465 |
| Molecular Formula | C28H28ClN3O7 |
| Molecular Weight | 554.00 g/mol |
| Exact Mass | 553.16 |
| IUPAC Name | 5-[4-(3-chlorophenyl)phenyl]-4-[[2-[4-(furan-2-carbonyl)piperazin-1-yl]-2-oxoacetyl]amino]-2-hydroxypentanoic acid |
| SMILES | O=C(NC(Cc1ccc(-c2cccc(Cl)c2)cc1)CC(O)C(=O)O)C(=O)N1CCN(C(=O)c2ccco2)CC1 |
| InChI | InChI=1S/C28H28ClN3O7/c29-21-4-1-3-20(16-21)19-8-6-18(7-9-19)15-22(17-23(33)28(37)38)30-25(34)27(36)32-12-10-31(11-13-32)26(35)24-5-2-14-39-24/h1-9,14,16,22-23,33H,10-13,15,17H2,(H,30,34)(H,37,38) |
| InChIKey | NSUNAWGBQYZTMU-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 140.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.00 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|