C25H29ClN2O6 — CID 78320813
5-[4-(3-chlorophenyl)phenyl]-2-hydroxy-4-[[2-[4-(hydroxymethyl)piperidin-1-yl]-2-oxoacetyl]amino]pentanoic acid (PubChem CID 78320813) has the molecular formula C25H29ClN2O6 and a molecular weight of 488.97 g/mol. Its IUPAC name is 5-[4-(3-chlorophenyl)phenyl]-2-hydroxy-4-[[2-[4-(hydroxymethyl)piperidin-1-yl]-2-oxoacetyl]amino]pentanoic acid.
| Compound Name | 5-[4-(3-chlorophenyl)phenyl]-2-hydroxy-4-[[2-[4-(hydroxymethyl)piperidin-1-yl]-2-oxoacetyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 78320813 |
| Molecular Formula | C25H29ClN2O6 |
| Molecular Weight | 488.97 g/mol |
| Exact Mass | 488.17 |
| IUPAC Name | 5-[4-(3-chlorophenyl)phenyl]-2-hydroxy-4-[[2-[4-(hydroxymethyl)piperidin-1-yl]-2-oxoacetyl]amino]pentanoic acid |
| SMILES | O=C(NC(Cc1ccc(-c2cccc(Cl)c2)cc1)CC(O)C(=O)O)C(=O)N1CCC(CO)CC1 |
| InChI | InChI=1S/C25H29ClN2O6/c26-20-3-1-2-19(13-20)18-6-4-16(5-7-18)12-21(14-22(30)25(33)34)27-23(31)24(32)28-10-8-17(15-29)9-11-28/h1-7,13,17,21-22,29-30H,8-12,14-15H2,(H,27,31)(H,33,34) |
| InChIKey | CGKWXUAKOVSEIP-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 127.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.97 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|