C25H29ClN2O6 — CID 90386759
(2R,4R)-5-[4-(3-chlorophenyl)phenyl]-2-hydroxy-4-[[2-[3-(hydroxymethyl)piperidin-1-yl]-2-oxoacetyl]amino]pentanoic acid (PubChem CID 90386759) has the molecular formula C25H29ClN2O6 and a molecular weight of 488.97 g/mol. Its IUPAC name is (2R,4R)-5-[4-(3-chlorophenyl)phenyl]-2-hydroxy-4-[[2-[3-(hydroxymethyl)piperidin-1-yl]-2-oxoacetyl]amino]pentanoic acid.
| Compound Name | (2R,4R)-5-[4-(3-chlorophenyl)phenyl]-2-hydroxy-4-[[2-[3-(hydroxymethyl)piperidin-1-yl]-2-oxoacetyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 90386759 |
| Molecular Formula | C25H29ClN2O6 |
| Molecular Weight | 488.97 g/mol |
| Exact Mass | 488.17 |
| IUPAC Name | (2R,4R)-5-[4-(3-chlorophenyl)phenyl]-2-hydroxy-4-[[2-[3-(hydroxymethyl)piperidin-1-yl]-2-oxoacetyl]amino]pentanoic acid |
| SMILES | O=C(N[C@H](Cc1ccc(-c2cccc(Cl)c2)cc1)C[C@@H](O)C(=O)O)C(=O)N1CCCC(CO)C1 |
| InChI | InChI=1S/C25H29ClN2O6/c26-20-5-1-4-19(12-20)18-8-6-16(7-9-18)11-21(13-22(30)25(33)34)27-23(31)24(32)28-10-2-3-17(14-28)15-29/h1,4-9,12,17,21-22,29-30H,2-3,10-11,13-15H2,(H,27,31)(H,33,34)/t17?,21-,22-/m1/s1 |
| InChIKey | SYRWBVNLUFTNOK-TWBYEDGTSA-N |
| XLogP | 2.10 |
| TPSA | 127.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.97 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|