C25H28ClN3O6 — CID 90387626
(2R,4R)-4-[[2-(4-carbamoylpiperidin-1-yl)-2-oxoacetyl]amino]-5-[4-(3-chlorophenyl)phenyl]-2-hydroxypentanoic acid (PubChem CID 90387626) has the molecular formula C25H28ClN3O6 and a molecular weight of 501.97 g/mol. Its IUPAC name is (2R,4R)-4-[[2-(4-carbamoylpiperidin-1-yl)-2-oxoacetyl]amino]-5-[4-(3-chlorophenyl)phenyl]-2-hydroxypentanoic acid.
| Compound Name | (2R,4R)-4-[[2-(4-carbamoylpiperidin-1-yl)-2-oxoacetyl]amino]-5-[4-(3-chlorophenyl)phenyl]-2-hydroxypentanoic acid |
|---|---|
| PubChem CID | 90387626 |
| Molecular Formula | C25H28ClN3O6 |
| Molecular Weight | 501.97 g/mol |
| Exact Mass | 501.17 |
| IUPAC Name | (2R,4R)-4-[[2-(4-carbamoylpiperidin-1-yl)-2-oxoacetyl]amino]-5-[4-(3-chlorophenyl)phenyl]-2-hydroxypentanoic acid |
| SMILES | NC(=O)C1CCN(C(=O)C(=O)N[C@H](Cc2ccc(-c3cccc(Cl)c3)cc2)C[C@@H](O)C(=O)O)CC1 |
| InChI | InChI=1S/C25H28ClN3O6/c26-19-3-1-2-18(13-19)16-6-4-15(5-7-16)12-20(14-21(30)25(34)35)28-23(32)24(33)29-10-8-17(9-11-29)22(27)31/h1-7,13,17,20-21,30H,8-12,14H2,(H2,27,31)(H,28,32)(H,34,35)/t20-,21-/m1/s1 |
| InChIKey | NJNLGJQTJNIYLL-NHCUHLMSSA-N |
| XLogP | 1.59 |
| TPSA | 150.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.97 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|