C27H33ClN4O4 — CID 90388337
5-[4-(3-chlorophenyl)phenyl]-2-hydroxy-4-[[1-hydroxy-5-(2-pyridin-4-ylhydrazinyl)pentyl]amino]pentanoic acid (PubChem CID 90388337) has the molecular formula C27H33ClN4O4 and a molecular weight of 513.04 g/mol. Its IUPAC name is 5-[4-(3-chlorophenyl)phenyl]-2-hydroxy-4-[[1-hydroxy-5-(2-pyridin-4-ylhydrazinyl)pentyl]amino]pentanoic acid.
| Compound Name | 5-[4-(3-chlorophenyl)phenyl]-2-hydroxy-4-[[1-hydroxy-5-(2-pyridin-4-ylhydrazinyl)pentyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 90388337 |
| Molecular Formula | C27H33ClN4O4 |
| Molecular Weight | 513.04 g/mol |
| Exact Mass | 512.22 |
| IUPAC Name | 5-[4-(3-chlorophenyl)phenyl]-2-hydroxy-4-[[1-hydroxy-5-(2-pyridin-4-ylhydrazinyl)pentyl]amino]pentanoic acid |
| SMILES | O=C(O)C(O)CC(Cc1ccc(-c2cccc(Cl)c2)cc1)NC(O)CCCCNNc1ccncc1 |
| InChI | InChI=1S/C27H33ClN4O4/c28-22-5-3-4-21(17-22)20-9-7-19(8-10-20)16-24(18-25(33)27(35)36)31-26(34)6-1-2-13-30-32-23-11-14-29-15-12-23/h3-5,7-12,14-15,17,24-26,30-31,33-34H,1-2,6,13,16,18H2,(H,29,32)(H,35,36) |
| InChIKey | HLVOOBRHEAXDGV-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 126.74 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.04 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|