C23H22ClFN4O7 — CID 129016847
acetyloxymethyl (4R)-5-[4-(5-chloro-2-fluorophenyl)phenyl]-2-hydroxy-4-[(1-hydroxytriazole-4-carbonyl)amino]pentanoate (PubChem CID 129016847) has the molecular formula C23H22ClFN4O7 and a molecular weight of 520.90 g/mol. Its IUPAC name is acetyloxymethyl (4R)-5-[4-(5-chloro-2-fluorophenyl)phenyl]-2-hydroxy-4-[(1-hydroxytriazole-4-carbonyl)amino]pentanoate.
| Compound Name | acetyloxymethyl (4R)-5-[4-(5-chloro-2-fluorophenyl)phenyl]-2-hydroxy-4-[(1-hydroxytriazole-4-carbonyl)amino]pentanoate |
|---|---|
| PubChem CID | 129016847 |
| Molecular Formula | C23H22ClFN4O7 |
| Molecular Weight | 520.90 g/mol |
| Exact Mass | 520.12 |
| IUPAC Name | acetyloxymethyl (4R)-5-[4-(5-chloro-2-fluorophenyl)phenyl]-2-hydroxy-4-[(1-hydroxytriazole-4-carbonyl)amino]pentanoate |
| SMILES | CC(=O)OCOC(=O)C(O)C[C@@H](Cc1ccc(-c2cc(Cl)ccc2F)cc1)NC(=O)c1cn(O)nn1 |
| InChI | InChI=1S/C23H22ClFN4O7/c1-13(30)35-12-36-23(33)21(31)10-17(26-22(32)20-11-29(34)28-27-20)8-14-2-4-15(5-3-14)18-9-16(24)6-7-19(18)25/h2-7,9,11,17,21,31,34H,8,10,12H2,1H3,(H,26,32)/t17-,21?/m1/s1 |
| InChIKey | CUWLKQQBQWLDCK-OQHSHRKDSA-N |
| XLogP | 2.13 |
| TPSA | 152.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.90 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|