C21H20ClFN6O6 — CID 123136450
acetyloxymethyl 3-[[4-(5-chloro-2-fluorophenyl)phenyl]methyl-(2H-tetrazole-5-carbonylamino)amino]-2-hydroxypropanoate (PubChem CID 123136450) has the molecular formula C21H20ClFN6O6 and a molecular weight of 506.88 g/mol. Its IUPAC name is acetyloxymethyl 3-[[4-(5-chloro-2-fluorophenyl)phenyl]methyl-(2H-tetrazole-5-carbonylamino)amino]-2-hydroxypropanoate.
| Compound Name | acetyloxymethyl 3-[[4-(5-chloro-2-fluorophenyl)phenyl]methyl-(2H-tetrazole-5-carbonylamino)amino]-2-hydroxypropanoate |
|---|---|
| PubChem CID | 123136450 |
| Molecular Formula | C21H20ClFN6O6 |
| Molecular Weight | 506.88 g/mol |
| Exact Mass | 506.11 |
| IUPAC Name | acetyloxymethyl 3-[[4-(5-chloro-2-fluorophenyl)phenyl]methyl-(2H-tetrazole-5-carbonylamino)amino]-2-hydroxypropanoate |
| SMILES | CC(=O)OCOC(=O)C(O)CN(Cc1ccc(-c2cc(Cl)ccc2F)cc1)NC(=O)c1nn[nH]n1 |
| InChI | InChI=1S/C21H20ClFN6O6/c1-12(30)34-11-35-21(33)18(31)10-29(26-20(32)19-24-27-28-25-19)9-13-2-4-14(5-3-13)16-8-15(22)6-7-17(16)23/h2-8,18,31H,9-11H2,1H3,(H,26,32)(H,24,25,27,28) |
| InChIKey | OURYNYHKLMPDHH-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 159.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.88 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|