C28H31ClFN5O7 — CID 123343543
[3-[[(3-acetyl-1H-pyrazole-5-carbonyl)amino]-[[4-(5-chloro-2-fluorophenyl)phenyl]methyl]amino]-2-hydroxypropanoyl]oxymethyl 2-amino-3-methylbutanoate (PubChem CID 123343543) has the molecular formula C28H31ClFN5O7 and a molecular weight of 604.04 g/mol. Its IUPAC name is [3-[[(3-acetyl-1H-pyrazole-5-carbonyl)amino]-[[4-(5-chloro-2-fluorophenyl)phenyl]methyl]amino]-2-hydroxypropanoyl]oxymethyl 2-amino-3-methylbutanoate.
| Compound Name | [3-[[(3-acetyl-1H-pyrazole-5-carbonyl)amino]-[[4-(5-chloro-2-fluorophenyl)phenyl]methyl]amino]-2-hydroxypropanoyl]oxymethyl 2-amino-3-methylbutanoate |
|---|---|
| PubChem CID | 123343543 |
| Molecular Formula | C28H31ClFN5O7 |
| Molecular Weight | 604.04 g/mol |
| Exact Mass | 603.19 |
| IUPAC Name | [3-[[(3-acetyl-1H-pyrazole-5-carbonyl)amino]-[[4-(5-chloro-2-fluorophenyl)phenyl]methyl]amino]-2-hydroxypropanoyl]oxymethyl 2-amino-3-methylbutanoate |
| SMILES | CC(=O)c1cc(C(=O)NN(Cc2ccc(-c3cc(Cl)ccc3F)cc2)CC(O)C(=O)OCOC(=O)C(N)C(C)C)[nH]n1 |
| InChI | InChI=1S/C28H31ClFN5O7/c1-15(2)25(31)28(40)42-14-41-27(39)24(37)13-35(34-26(38)23-11-22(16(3)36)32-33-23)12-17-4-6-18(7-5-17)20-10-19(29)8-9-21(20)30/h4-11,15,24-25,37H,12-14,31H2,1-3H3,(H,32,33)(H,34,38) |
| InChIKey | RWYCBQXVUGRZGP-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 176.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.04 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|