C18H16ClFN6O4 — CID 67972427
3-[[4-(5-chloro-2-fluorophenyl)phenyl]methyl-(2H-tetrazole-5-carbonylamino)amino]-2-hydroxypropanoic acid (PubChem CID 67972427) has the molecular formula C18H16ClFN6O4 and a molecular weight of 434.82 g/mol. Its IUPAC name is 3-[[4-(5-chloro-2-fluorophenyl)phenyl]methyl-(2H-tetrazole-5-carbonylamino)amino]-2-hydroxypropanoic acid.
| Compound Name | 3-[[4-(5-chloro-2-fluorophenyl)phenyl]methyl-(2H-tetrazole-5-carbonylamino)amino]-2-hydroxypropanoic acid |
|---|---|
| PubChem CID | 67972427 |
| Molecular Formula | C18H16ClFN6O4 |
| Molecular Weight | 434.82 g/mol |
| Exact Mass | 434.09 |
| IUPAC Name | 3-[[4-(5-chloro-2-fluorophenyl)phenyl]methyl-(2H-tetrazole-5-carbonylamino)amino]-2-hydroxypropanoic acid |
| SMILES | O=C(NN(Cc1ccc(-c2cc(Cl)ccc2F)cc1)CC(O)C(=O)O)c1nn[nH]n1 |
| InChI | InChI=1S/C18H16ClFN6O4/c19-12-5-6-14(20)13(7-12)11-3-1-10(2-4-11)8-26(9-15(27)18(29)30)23-17(28)16-21-24-25-22-16/h1-7,15,27H,8-9H2,(H,23,28)(H,29,30)(H,21,22,24,25) |
| InChIKey | CLZMDEXZHTVILM-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 144.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.82 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|