C20H20ClN5O5 — CID 67975355
(2R)-3-[[4-(5-chloro-2-methylphenyl)phenyl]methyl-[(1-hydroxytriazole-4-carbonyl)amino]amino]-2-hydroxypropanoic acid (PubChem CID 67975355) has the molecular formula C20H20ClN5O5 and a molecular weight of 445.86 g/mol. Its IUPAC name is (2R)-3-[[4-(5-chloro-2-methylphenyl)phenyl]methyl-[(1-hydroxytriazole-4-carbonyl)amino]amino]-2-hydroxypropanoic acid.
| Compound Name | (2R)-3-[[4-(5-chloro-2-methylphenyl)phenyl]methyl-[(1-hydroxytriazole-4-carbonyl)amino]amino]-2-hydroxypropanoic acid |
|---|---|
| PubChem CID | 67975355 |
| Molecular Formula | C20H20ClN5O5 |
| Molecular Weight | 445.86 g/mol |
| Exact Mass | 445.12 |
| IUPAC Name | (2R)-3-[[4-(5-chloro-2-methylphenyl)phenyl]methyl-[(1-hydroxytriazole-4-carbonyl)amino]amino]-2-hydroxypropanoic acid |
| SMILES | Cc1ccc(Cl)cc1-c1ccc(CN(C[C@@H](O)C(=O)O)NC(=O)c2cn(O)nn2)cc1 |
| InChI | InChI=1S/C20H20ClN5O5/c1-12-2-7-15(21)8-16(12)14-5-3-13(4-6-14)9-25(11-18(27)20(29)30)23-19(28)17-10-26(31)24-22-17/h2-8,10,18,27,31H,9,11H2,1H3,(H,23,28)(H,29,30)/t18-/m1/s1 |
| InChIKey | OEKVRGZFNJGZCU-GOSISDBHSA-N |
| XLogP | 1.74 |
| TPSA | 140.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.86 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|