C20H20Cl2N2O6 — CID 166638717
(2R)-3-[[3-chloro-4-(4-chlorophenyl)phenyl]methyl-[(2-ethoxy-2-oxoacetyl)amino]amino]-2-hydroxypropanoic acid (PubChem CID 166638717) has the molecular formula C20H20Cl2N2O6 and a molecular weight of 455.29 g/mol. Its IUPAC name is (2R)-3-[[3-chloro-4-(4-chlorophenyl)phenyl]methyl-[(2-ethoxy-2-oxoacetyl)amino]amino]-2-hydroxypropanoic acid.
| Compound Name | (2R)-3-[[3-chloro-4-(4-chlorophenyl)phenyl]methyl-[(2-ethoxy-2-oxoacetyl)amino]amino]-2-hydroxypropanoic acid |
|---|---|
| PubChem CID | 166638717 |
| Molecular Formula | C20H20Cl2N2O6 |
| Molecular Weight | 455.29 g/mol |
| Exact Mass | 454.07 |
| IUPAC Name | (2R)-3-[[3-chloro-4-(4-chlorophenyl)phenyl]methyl-[(2-ethoxy-2-oxoacetyl)amino]amino]-2-hydroxypropanoic acid |
| SMILES | CCOC(=O)C(=O)NN(Cc1ccc(-c2ccc(Cl)cc2)c(Cl)c1)C[C@@H](O)C(=O)O |
| InChI | InChI=1S/C20H20Cl2N2O6/c1-2-30-20(29)18(26)23-24(11-17(25)19(27)28)10-12-3-8-15(16(22)9-12)13-4-6-14(21)7-5-13/h3-9,17,25H,2,10-11H2,1H3,(H,23,26)(H,27,28)/t17-/m1/s1 |
| InChIKey | GADXCEFVIQBOFT-QGZVFWFLSA-N |
| XLogP | 2.50 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.29 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|