C26H31Cl2N5O5 — CID 67972980
heptyl 3-[[4-(2,5-dichlorophenyl)phenyl]methyl-[(1-hydroxytriazole-4-carbonyl)amino]amino]-2-hydroxypropanoate (PubChem CID 67972980) has the molecular formula C26H31Cl2N5O5 and a molecular weight of 564.47 g/mol. Its IUPAC name is heptyl 3-[[4-(2,5-dichlorophenyl)phenyl]methyl-[(1-hydroxytriazole-4-carbonyl)amino]amino]-2-hydroxypropanoate.
| Compound Name | heptyl 3-[[4-(2,5-dichlorophenyl)phenyl]methyl-[(1-hydroxytriazole-4-carbonyl)amino]amino]-2-hydroxypropanoate |
|---|---|
| PubChem CID | 67972980 |
| Molecular Formula | C26H31Cl2N5O5 |
| Molecular Weight | 564.47 g/mol |
| Exact Mass | 563.17 |
| IUPAC Name | heptyl 3-[[4-(2,5-dichlorophenyl)phenyl]methyl-[(1-hydroxytriazole-4-carbonyl)amino]amino]-2-hydroxypropanoate |
| SMILES | CCCCCCCOC(=O)C(O)CN(Cc1ccc(-c2cc(Cl)ccc2Cl)cc1)NC(=O)c1cn(O)nn1 |
| InChI | InChI=1S/C26H31Cl2N5O5/c1-2-3-4-5-6-13-38-26(36)24(34)17-32(30-25(35)23-16-33(37)31-29-23)15-18-7-9-19(10-8-18)21-14-20(27)11-12-22(21)28/h7-12,14,16,24,34,37H,2-6,13,15,17H2,1H3,(H,30,35) |
| InChIKey | KEULXDFTGTZWBN-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 129.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.47 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|