C22H23ClN4O5 — CID 76530401
ethyl 5-[4-(3-chlorophenyl)phenyl]-2-hydroxy-4-[(1-hydroxytriazole-4-carbonyl)amino]pentanoate (PubChem CID 76530401) has the molecular formula C22H23ClN4O5 and a molecular weight of 458.90 g/mol. Its IUPAC name is ethyl 5-[4-(3-chlorophenyl)phenyl]-2-hydroxy-4-[(1-hydroxytriazole-4-carbonyl)amino]pentanoate.
| Compound Name | ethyl 5-[4-(3-chlorophenyl)phenyl]-2-hydroxy-4-[(1-hydroxytriazole-4-carbonyl)amino]pentanoate |
|---|---|
| PubChem CID | 76530401 |
| Molecular Formula | C22H23ClN4O5 |
| Molecular Weight | 458.90 g/mol |
| Exact Mass | 458.14 |
| IUPAC Name | ethyl 5-[4-(3-chlorophenyl)phenyl]-2-hydroxy-4-[(1-hydroxytriazole-4-carbonyl)amino]pentanoate |
| SMILES | CCOC(=O)C(O)CC(Cc1ccc(-c2cccc(Cl)c2)cc1)NC(=O)c1cn(O)nn1 |
| InChI | InChI=1S/C22H23ClN4O5/c1-2-32-22(30)20(28)12-18(24-21(29)19-13-27(31)26-25-19)10-14-6-8-15(9-7-14)16-4-3-5-17(23)11-16/h3-9,11,13,18,20,28,31H,2,10,12H2,1H3,(H,24,29) |
| InChIKey | DVHWLFDNWHQEFR-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 126.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.90 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|