C23H24Cl2N4O5 — CID 67976001
propan-2-yl 5-[4-(2,5-dichlorophenyl)phenyl]-2-hydroxy-4-[(1-hydroxytriazole-4-carbonyl)amino]pentanoate (PubChem CID 67976001) has the molecular formula C23H24Cl2N4O5 and a molecular weight of 507.37 g/mol. Its IUPAC name is propan-2-yl 5-[4-(2,5-dichlorophenyl)phenyl]-2-hydroxy-4-[(1-hydroxytriazole-4-carbonyl)amino]pentanoate.
| Compound Name | propan-2-yl 5-[4-(2,5-dichlorophenyl)phenyl]-2-hydroxy-4-[(1-hydroxytriazole-4-carbonyl)amino]pentanoate |
|---|---|
| PubChem CID | 67976001 |
| Molecular Formula | C23H24Cl2N4O5 |
| Molecular Weight | 507.37 g/mol |
| Exact Mass | 506.11 |
| IUPAC Name | propan-2-yl 5-[4-(2,5-dichlorophenyl)phenyl]-2-hydroxy-4-[(1-hydroxytriazole-4-carbonyl)amino]pentanoate |
| SMILES | CC(C)OC(=O)C(O)CC(Cc1ccc(-c2cc(Cl)ccc2Cl)cc1)NC(=O)c1cn(O)nn1 |
| InChI | InChI=1S/C23H24Cl2N4O5/c1-13(2)34-23(32)21(30)11-17(26-22(31)20-12-29(33)28-27-20)9-14-3-5-15(6-4-14)18-10-16(24)7-8-19(18)25/h3-8,10,12-13,17,21,30,33H,9,11H2,1-2H3,(H,26,31) |
| InChIKey | OWHOKSVCXOXENB-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 126.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.37 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|