C28H28Cl2N4O5 — CID 67969794
2-methylpropyl (2R,4R)-5-[4-(2,5-dichlorophenyl)phenyl]-2-hydroxy-4-[(3-hydroxybenzotriazole-5-carbonyl)amino]pentanoate (PubChem CID 67969794) has the molecular formula C28H28Cl2N4O5 and a molecular weight of 571.46 g/mol. Its IUPAC name is 2-methylpropyl (2R,4R)-5-[4-(2,5-dichlorophenyl)phenyl]-2-hydroxy-4-[(3-hydroxybenzotriazole-5-carbonyl)amino]pentanoate.
| Compound Name | 2-methylpropyl (2R,4R)-5-[4-(2,5-dichlorophenyl)phenyl]-2-hydroxy-4-[(3-hydroxybenzotriazole-5-carbonyl)amino]pentanoate |
|---|---|
| PubChem CID | 67969794 |
| Molecular Formula | C28H28Cl2N4O5 |
| Molecular Weight | 571.46 g/mol |
| Exact Mass | 570.14 |
| IUPAC Name | 2-methylpropyl (2R,4R)-5-[4-(2,5-dichlorophenyl)phenyl]-2-hydroxy-4-[(3-hydroxybenzotriazole-5-carbonyl)amino]pentanoate |
| SMILES | CC(C)COC(=O)[C@H](O)C[C@@H](Cc1ccc(-c2cc(Cl)ccc2Cl)cc1)NC(=O)c1ccc2nnn(O)c2c1 |
| InChI | InChI=1S/C28H28Cl2N4O5/c1-16(2)15-39-28(37)26(35)14-21(31-27(36)19-7-10-24-25(12-19)34(38)33-32-24)11-17-3-5-18(6-4-17)22-13-20(29)8-9-23(22)30/h3-10,12-13,16,21,26,35,38H,11,14-15H2,1-2H3,(H,31,36)/t21-,26-/m1/s1 |
| InChIKey | UMBDXJQLXVHGIC-QFQXNSOFSA-N |
| XLogP | 4.93 |
| TPSA | 126.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.46 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|