C18H17ClN2O6 — CID 123594929
3-[[4-(3-chlorophenyl)phenyl]methyl-(oxaloamino)amino]-2-hydroxypropanoic acid (PubChem CID 123594929) has the molecular formula C18H17ClN2O6 and a molecular weight of 392.80 g/mol. Its IUPAC name is 3-[[4-(3-chlorophenyl)phenyl]methyl-(oxaloamino)amino]-2-hydroxypropanoic acid.
| Compound Name | 3-[[4-(3-chlorophenyl)phenyl]methyl-(oxaloamino)amino]-2-hydroxypropanoic acid |
|---|---|
| PubChem CID | 123594929 |
| Molecular Formula | C18H17ClN2O6 |
| Molecular Weight | 392.80 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | 3-[[4-(3-chlorophenyl)phenyl]methyl-(oxaloamino)amino]-2-hydroxypropanoic acid |
| SMILES | O=C(O)C(=O)NN(Cc1ccc(-c2cccc(Cl)c2)cc1)CC(O)C(=O)O |
| InChI | InChI=1S/C18H17ClN2O6/c19-14-3-1-2-13(8-14)12-6-4-11(5-7-12)9-21(10-15(22)17(24)25)20-16(23)18(26)27/h1-8,15,22H,9-10H2,(H,20,23)(H,24,25)(H,26,27) |
| InChIKey | JYQAYNBQWZLMHO-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 127.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.80 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|