C20H18ClN3O7 — CID 67972577
3-[[4-(3-chloro-5-hydroxyphenyl)phenyl]methyl-[(3-oxo-1,2-oxazole-5-carbonyl)amino]amino]-2-hydroxypropanoic acid (PubChem CID 67972577) has the molecular formula C20H18ClN3O7 and a molecular weight of 447.83 g/mol. Its IUPAC name is 3-[[4-(3-chloro-5-hydroxyphenyl)phenyl]methyl-[(3-oxo-1,2-oxazole-5-carbonyl)amino]amino]-2-hydroxypropanoic acid.
| Compound Name | 3-[[4-(3-chloro-5-hydroxyphenyl)phenyl]methyl-[(3-oxo-1,2-oxazole-5-carbonyl)amino]amino]-2-hydroxypropanoic acid |
|---|---|
| PubChem CID | 67972577 |
| Molecular Formula | C20H18ClN3O7 |
| Molecular Weight | 447.83 g/mol |
| Exact Mass | 447.08 |
| IUPAC Name | 3-[[4-(3-chloro-5-hydroxyphenyl)phenyl]methyl-[(3-oxo-1,2-oxazole-5-carbonyl)amino]amino]-2-hydroxypropanoic acid |
| SMILES | O=C(NN(Cc1ccc(-c2cc(O)cc(Cl)c2)cc1)CC(O)C(=O)O)c1cc(=O)[nH]o1 |
| InChI | InChI=1S/C20H18ClN3O7/c21-14-5-13(6-15(25)7-14)12-3-1-11(2-4-12)9-24(10-16(26)20(29)30)22-19(28)17-8-18(27)23-31-17/h1-8,16,25-26H,9-10H2,(H,22,28)(H,23,27)(H,29,30) |
| InChIKey | SQXWIOCMDJFUQX-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 156.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.83 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|