C22H19ClN4O7 — CID 67972803
4-[[(2-carboxy-2-hydroxyethyl)-[[4-(3-chlorophenyl)phenyl]methyl]amino]carbamoyl]-2-oxo-1H-pyrimidine-6-carboxylic acid (PubChem CID 67972803) has the molecular formula C22H19ClN4O7 and a molecular weight of 486.87 g/mol. Its IUPAC name is 4-[[(2-carboxy-2-hydroxyethyl)-[[4-(3-chlorophenyl)phenyl]methyl]amino]carbamoyl]-2-oxo-1H-pyrimidine-6-carboxylic acid.
| Compound Name | 4-[[(2-carboxy-2-hydroxyethyl)-[[4-(3-chlorophenyl)phenyl]methyl]amino]carbamoyl]-2-oxo-1H-pyrimidine-6-carboxylic acid |
|---|---|
| PubChem CID | 67972803 |
| Molecular Formula | C22H19ClN4O7 |
| Molecular Weight | 486.87 g/mol |
| Exact Mass | 486.09 |
| IUPAC Name | 4-[[(2-carboxy-2-hydroxyethyl)-[[4-(3-chlorophenyl)phenyl]methyl]amino]carbamoyl]-2-oxo-1H-pyrimidine-6-carboxylic acid |
| SMILES | O=C(NN(Cc1ccc(-c2cccc(Cl)c2)cc1)CC(O)C(=O)O)c1cc(C(=O)O)[nH]c(=O)n1 |
| InChI | InChI=1S/C22H19ClN4O7/c23-15-3-1-2-14(8-15)13-6-4-12(5-7-13)10-27(11-18(28)21(32)33)26-19(29)16-9-17(20(30)31)25-22(34)24-16/h1-9,18,28H,10-11H2,(H,26,29)(H,30,31)(H,32,33)(H,24,25,34) |
| InChIKey | ONXYHKYALSQOHQ-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 172.92 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.87 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|