C21H20N4O6 — CID 57378315
3-[[[(2S)-2-carboxy-2-hydroxyethyl]-[(4-phenylphenyl)methyl]amino]carbamoyl]-1H-pyrazole-5-carboxylic acid (PubChem CID 57378315) has the molecular formula C21H20N4O6 and a molecular weight of 424.41 g/mol. Its IUPAC name is 3-[[[(2S)-2-carboxy-2-hydroxyethyl]-[(4-phenylphenyl)methyl]amino]carbamoyl]-1H-pyrazole-5-carboxylic acid.
| Compound Name | 3-[[[(2S)-2-carboxy-2-hydroxyethyl]-[(4-phenylphenyl)methyl]amino]carbamoyl]-1H-pyrazole-5-carboxylic acid |
|---|---|
| PubChem CID | 57378315 |
| Molecular Formula | C21H20N4O6 |
| Molecular Weight | 424.41 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | 3-[[[(2S)-2-carboxy-2-hydroxyethyl]-[(4-phenylphenyl)methyl]amino]carbamoyl]-1H-pyrazole-5-carboxylic acid |
| SMILES | O=C(NN(Cc1ccc(-c2ccccc2)cc1)C[C@H](O)C(=O)O)c1cc(C(=O)O)[nH]n1 |
| InChI | InChI=1S/C21H20N4O6/c26-18(21(30)31)12-25(24-19(27)16-10-17(20(28)29)23-22-16)11-13-6-8-15(9-7-13)14-4-2-1-3-5-14/h1-10,18,26H,11-12H2,(H,22,23)(H,24,27)(H,28,29)(H,30,31)/t18-/m0/s1 |
| InChIKey | WUCWFVWEQMDNHH-SFHVURJKSA-N |
| XLogP | 1.37 |
| TPSA | 155.85 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.41 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|