C26H24N4O4 — CID 67973699
(2R)-2-hydroxy-3-[(4-phenylphenyl)methyl-[(3-phenyl-1H-pyrazole-5-carbonyl)amino]amino]propanoic acid (PubChem CID 67973699) has the molecular formula C26H24N4O4 and a molecular weight of 456.50 g/mol. Its IUPAC name is (2R)-2-hydroxy-3-[(4-phenylphenyl)methyl-[(3-phenyl-1H-pyrazole-5-carbonyl)amino]amino]propanoic acid.
| Compound Name | (2R)-2-hydroxy-3-[(4-phenylphenyl)methyl-[(3-phenyl-1H-pyrazole-5-carbonyl)amino]amino]propanoic acid |
|---|---|
| PubChem CID | 67973699 |
| Molecular Formula | C26H24N4O4 |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | (2R)-2-hydroxy-3-[(4-phenylphenyl)methyl-[(3-phenyl-1H-pyrazole-5-carbonyl)amino]amino]propanoic acid |
| SMILES | O=C(NN(Cc1ccc(-c2ccccc2)cc1)C[C@@H](O)C(=O)O)c1cc(-c2ccccc2)n[nH]1 |
| InChI | InChI=1S/C26H24N4O4/c31-24(26(33)34)17-30(16-18-11-13-20(14-12-18)19-7-3-1-4-8-19)29-25(32)23-15-22(27-28-23)21-9-5-2-6-10-21/h1-15,24,31H,16-17H2,(H,27,28)(H,29,32)(H,33,34)/t24-/m1/s1 |
| InChIKey | MYYWKSMSTZEFLY-XMMPIXPASA-N |
| XLogP | 3.34 |
| TPSA | 118.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.50 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|