C23H26N6O7S — CID 67972715
(2R)-2-hydroxy-3-[(4-phenylphenyl)methyl-[[5-(2-sulfamoylethylcarbamoyl)-1H-pyrazole-3-carbonyl]amino]amino]propanoic acid (PubChem CID 67972715) has the molecular formula C23H26N6O7S and a molecular weight of 530.56 g/mol. Its IUPAC name is (2R)-2-hydroxy-3-[(4-phenylphenyl)methyl-[[5-(2-sulfamoylethylcarbamoyl)-1H-pyrazole-3-carbonyl]amino]amino]propanoic acid.
| Compound Name | (2R)-2-hydroxy-3-[(4-phenylphenyl)methyl-[[5-(2-sulfamoylethylcarbamoyl)-1H-pyrazole-3-carbonyl]amino]amino]propanoic acid |
|---|---|
| PubChem CID | 67972715 |
| Molecular Formula | C23H26N6O7S |
| Molecular Weight | 530.56 g/mol |
| Exact Mass | 530.16 |
| IUPAC Name | (2R)-2-hydroxy-3-[(4-phenylphenyl)methyl-[[5-(2-sulfamoylethylcarbamoyl)-1H-pyrazole-3-carbonyl]amino]amino]propanoic acid |
| SMILES | NS(=O)(=O)CCNC(=O)c1cc(C(=O)NN(Cc2ccc(-c3ccccc3)cc2)C[C@@H](O)C(=O)O)n[nH]1 |
| InChI | InChI=1S/C23H26N6O7S/c24-37(35,36)11-10-25-21(31)18-12-19(27-26-18)22(32)28-29(14-20(30)23(33)34)13-15-6-8-17(9-7-15)16-4-2-1-3-5-16/h1-9,12,20,30H,10-11,13-14H2,(H,25,31)(H,26,27)(H,28,32)(H,33,34)(H2,24,35,36)/t20-/m1/s1 |
| InChIKey | LXXBYTNRRRJSRJ-HXUWFJFHSA-N |
| XLogP | -0.31 |
| TPSA | 207.81 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.56 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|