C22H19ClN4O6 — CID 67972294
6-[[(2-carboxy-2-hydroxyethyl)-[[4-(3-chlorophenyl)phenyl]methyl]amino]carbamoyl]pyrimidine-4-carboxylic acid (PubChem CID 67972294) has the molecular formula C22H19ClN4O6 and a molecular weight of 470.87 g/mol. Its IUPAC name is 6-[[(2-carboxy-2-hydroxyethyl)-[[4-(3-chlorophenyl)phenyl]methyl]amino]carbamoyl]pyrimidine-4-carboxylic acid.
| Compound Name | 6-[[(2-carboxy-2-hydroxyethyl)-[[4-(3-chlorophenyl)phenyl]methyl]amino]carbamoyl]pyrimidine-4-carboxylic acid |
|---|---|
| PubChem CID | 67972294 |
| Molecular Formula | C22H19ClN4O6 |
| Molecular Weight | 470.87 g/mol |
| Exact Mass | 470.10 |
| IUPAC Name | 6-[[(2-carboxy-2-hydroxyethyl)-[[4-(3-chlorophenyl)phenyl]methyl]amino]carbamoyl]pyrimidine-4-carboxylic acid |
| SMILES | O=C(O)c1cc(C(=O)NN(Cc2ccc(-c3cccc(Cl)c3)cc2)CC(O)C(=O)O)ncn1 |
| InChI | InChI=1S/C22H19ClN4O6/c23-16-3-1-2-15(8-16)14-6-4-13(5-7-14)10-27(11-19(28)22(32)33)26-20(29)17-9-18(21(30)31)25-12-24-17/h1-9,12,19,28H,10-11H2,(H,26,29)(H,30,31)(H,32,33) |
| InChIKey | ASQUVIOCMCNEST-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 152.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.87 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|