C21H18F3N3O6 — CID 67973006
(2R)-2-hydroxy-3-[[(3-oxo-1,2-oxazole-5-carbonyl)amino]-[[4-[3-(trifluoromethyl)phenyl]phenyl]methyl]amino]propanoic acid (PubChem CID 67973006) has the molecular formula C21H18F3N3O6 and a molecular weight of 465.38 g/mol. Its IUPAC name is (2R)-2-hydroxy-3-[[(3-oxo-1,2-oxazole-5-carbonyl)amino]-[[4-[3-(trifluoromethyl)phenyl]phenyl]methyl]amino]propanoic acid.
| Compound Name | (2R)-2-hydroxy-3-[[(3-oxo-1,2-oxazole-5-carbonyl)amino]-[[4-[3-(trifluoromethyl)phenyl]phenyl]methyl]amino]propanoic acid |
|---|---|
| PubChem CID | 67973006 |
| Molecular Formula | C21H18F3N3O6 |
| Molecular Weight | 465.38 g/mol |
| Exact Mass | 465.11 |
| IUPAC Name | (2R)-2-hydroxy-3-[[(3-oxo-1,2-oxazole-5-carbonyl)amino]-[[4-[3-(trifluoromethyl)phenyl]phenyl]methyl]amino]propanoic acid |
| SMILES | O=C(NN(Cc1ccc(-c2cccc(C(F)(F)F)c2)cc1)C[C@@H](O)C(=O)O)c1cc(=O)[nH]o1 |
| InChI | InChI=1S/C21H18F3N3O6/c22-21(23,24)15-3-1-2-14(8-15)13-6-4-12(5-7-13)10-27(11-16(28)20(31)32)25-19(30)17-9-18(29)26-33-17/h1-9,16,28H,10-11H2,(H,25,30)(H,26,29)(H,31,32)/t16-/m1/s1 |
| InChIKey | STZGCOOMPGVTNF-MRXNPFEDSA-N |
| XLogP | 2.25 |
| TPSA | 135.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.38 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|