C17H14ClN3O3 — CID 141386136
N'-[[4-(3-chlorophenyl)phenyl]methyl]-3-oxo-1,2-oxazole-5-carbohydrazide (PubChem CID 141386136) has the molecular formula C17H14ClN3O3 and a molecular weight of 343.77 g/mol. Its IUPAC name is N'-[[4-(3-chlorophenyl)phenyl]methyl]-3-oxo-1,2-oxazole-5-carbohydrazide.
| Compound Name | N'-[[4-(3-chlorophenyl)phenyl]methyl]-3-oxo-1,2-oxazole-5-carbohydrazide |
|---|---|
| PubChem CID | 141386136 |
| Molecular Formula | C17H14ClN3O3 |
| Molecular Weight | 343.77 g/mol |
| Exact Mass | 343.07 |
| IUPAC Name | N'-[[4-(3-chlorophenyl)phenyl]methyl]-3-oxo-1,2-oxazole-5-carbohydrazide |
| SMILES | O=C(NNCc1ccc(-c2cccc(Cl)c2)cc1)c1cc(=O)[nH]o1 |
| InChI | InChI=1S/C17H14ClN3O3/c18-14-3-1-2-13(8-14)12-6-4-11(5-7-12)10-19-20-17(23)15-9-16(22)21-24-15/h1-9,19H,10H2,(H,20,23)(H,21,22) |
| InChIKey | QTNWIJHAFMVGDW-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 87.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.77 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|