C29H38ClN5O8 — CID 71744724
(2S)-2,6-diaminohexanoic acid;propan-2-yl (2R)-3-[[4-(3-chlorophenyl)phenyl]methyl-[(3-oxo-1,2-oxazole-5-carbonyl)amino]amino]-2-hydroxypropanoate (PubChem CID 71744724) has the molecular formula C29H38ClN5O8 and a molecular weight of 620.10 g/mol. Its IUPAC name is (2S)-2,6-diaminohexanoic acid;propan-2-yl (2R)-3-[[4-(3-chlorophenyl)phenyl]methyl-[(3-oxo-1,2-oxazole-5-carbonyl)amino]amino]-2-hydroxypropanoate.
| Compound Name | (2S)-2,6-diaminohexanoic acid;propan-2-yl (2R)-3-[[4-(3-chlorophenyl)phenyl]methyl-[(3-oxo-1,2-oxazole-5-carbonyl)amino]amino]-2-hydroxypropanoate |
|---|---|
| PubChem CID | 71744724 |
| Molecular Formula | C29H38ClN5O8 |
| Molecular Weight | 620.10 g/mol |
| Exact Mass | 619.24 |
| IUPAC Name | (2S)-2,6-diaminohexanoic acid;propan-2-yl (2R)-3-[[4-(3-chlorophenyl)phenyl]methyl-[(3-oxo-1,2-oxazole-5-carbonyl)amino]amino]-2-hydroxypropanoate |
| SMILES | CC(C)OC(=O)[C@H](O)CN(Cc1ccc(-c2cccc(Cl)c2)cc1)NC(=O)c1cc(=O)[nH]o1.NCCCC[C@H](N)C(=O)O |
| InChI | InChI=1S/C23H24ClN3O6.C6H14N2O2/c1-14(2)32-23(31)19(28)13-27(25-22(30)20-11-21(29)26-33-20)12-15-6-8-16(9-7-15)17-4-3-5-18(24)10-17;7-4-2-1-3-5(8)6(9)10/h3-11,14,19,28H,12-13H2,1-2H3,(H,25,30)(H,26,29);5H,1-4,7-8H2,(H,9,10)/t19-;5-/m10/s1 |
| InChIKey | MLWIFQBYWJHKAR-GSYMTMJUSA-N |
| XLogP | 2.28 |
| TPSA | 214.21 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.10 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|