C23H23ClFN3O6 — CID 67972331
propan-2-yl 3-[[4-(3-chlorophenyl)-2-fluorophenyl]methyl-[(3-oxo-1,2-oxazole-5-carbonyl)amino]amino]-2-hydroxypropanoate (PubChem CID 67972331) has the molecular formula C23H23ClFN3O6 and a molecular weight of 491.90 g/mol. Its IUPAC name is propan-2-yl 3-[[4-(3-chlorophenyl)-2-fluorophenyl]methyl-[(3-oxo-1,2-oxazole-5-carbonyl)amino]amino]-2-hydroxypropanoate.
| Compound Name | propan-2-yl 3-[[4-(3-chlorophenyl)-2-fluorophenyl]methyl-[(3-oxo-1,2-oxazole-5-carbonyl)amino]amino]-2-hydroxypropanoate |
|---|---|
| PubChem CID | 67972331 |
| Molecular Formula | C23H23ClFN3O6 |
| Molecular Weight | 491.90 g/mol |
| Exact Mass | 491.13 |
| IUPAC Name | propan-2-yl 3-[[4-(3-chlorophenyl)-2-fluorophenyl]methyl-[(3-oxo-1,2-oxazole-5-carbonyl)amino]amino]-2-hydroxypropanoate |
| SMILES | CC(C)OC(=O)C(O)CN(Cc1ccc(-c2cccc(Cl)c2)cc1F)NC(=O)c1cc(=O)[nH]o1 |
| InChI | InChI=1S/C23H23ClFN3O6/c1-13(2)33-23(32)19(29)12-28(26-22(31)20-10-21(30)27-34-20)11-16-7-6-15(9-18(16)25)14-4-3-5-17(24)8-14/h3-10,13,19,29H,11-12H2,1-2H3,(H,26,31)(H,27,30) |
| InChIKey | WRHWFTJTQFGIEE-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 124.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.90 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|