C23H22ClNO2 — CID 59607810
(4R)-4-amino-5-[4-(3-chlorophenyl)phenyl]-1-phenoxypentan-2-one (PubChem CID 59607810) has the molecular formula C23H22ClNO2 and a molecular weight of 379.89 g/mol. Its IUPAC name is (4R)-4-amino-5-[4-(3-chlorophenyl)phenyl]-1-phenoxypentan-2-one.
| Compound Name | (4R)-4-amino-5-[4-(3-chlorophenyl)phenyl]-1-phenoxypentan-2-one |
|---|---|
| PubChem CID | 59607810 |
| Molecular Formula | C23H22ClNO2 |
| Molecular Weight | 379.89 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | (4R)-4-amino-5-[4-(3-chlorophenyl)phenyl]-1-phenoxypentan-2-one |
| SMILES | N[C@@H](CC(=O)COc1ccccc1)Cc1ccc(-c2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C23H22ClNO2/c24-20-6-4-5-19(14-20)18-11-9-17(10-12-18)13-21(25)15-22(26)16-27-23-7-2-1-3-8-23/h1-12,14,21H,13,15-16,25H2/t21-/m1/s1 |
| InChIKey | JPYAGMBUVNPXEN-OAQYLSRUSA-N |
| XLogP | 4.91 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.89 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |