C22H28ClNO3 — CID 155105000
(2S,4R)-4-amino-5-[4-(3-chlorophenyl)phenyl]-2-(2-ethoxyethyl)-2-methylpentanoic acid (PubChem CID 155105000) has the molecular formula C22H28ClNO3 and a molecular weight of 389.92 g/mol. Its IUPAC name is (2S,4R)-4-amino-5-[4-(3-chlorophenyl)phenyl]-2-(2-ethoxyethyl)-2-methylpentanoic acid.
| Compound Name | (2S,4R)-4-amino-5-[4-(3-chlorophenyl)phenyl]-2-(2-ethoxyethyl)-2-methylpentanoic acid |
|---|---|
| PubChem CID | 155105000 |
| Molecular Formula | C22H28ClNO3 |
| Molecular Weight | 389.92 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | (2S,4R)-4-amino-5-[4-(3-chlorophenyl)phenyl]-2-(2-ethoxyethyl)-2-methylpentanoic acid |
| SMILES | CCOCC[C@](C)(C[C@H](N)Cc1ccc(-c2cccc(Cl)c2)cc1)C(=O)O |
| InChI | InChI=1S/C22H28ClNO3/c1-3-27-12-11-22(2,21(25)26)15-20(24)13-16-7-9-17(10-8-16)18-5-4-6-19(23)14-18/h4-10,14,20H,3,11-13,15,24H2,1-2H3,(H,25,26)/t20-,22-/m1/s1 |
| InChIKey | IVCZEIGOFIPDPF-IFMALSPDSA-N |
| XLogP | 4.78 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.92 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|