C21H27NO3 — CID 123675450
4-amino-2-(ethoxymethyl)-2-methyl-5-(4-phenylphenyl)pentanoic acid (PubChem CID 123675450) has the molecular formula C21H27NO3 and a molecular weight of 341.45 g/mol. Its IUPAC name is 4-amino-2-(ethoxymethyl)-2-methyl-5-(4-phenylphenyl)pentanoic acid.
| Compound Name | 4-amino-2-(ethoxymethyl)-2-methyl-5-(4-phenylphenyl)pentanoic acid |
|---|---|
| PubChem CID | 123675450 |
| Molecular Formula | C21H27NO3 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | 4-amino-2-(ethoxymethyl)-2-methyl-5-(4-phenylphenyl)pentanoic acid |
| SMILES | CCOCC(C)(CC(N)Cc1ccc(-c2ccccc2)cc1)C(=O)O |
| InChI | InChI=1S/C21H27NO3/c1-3-25-15-21(2,20(23)24)14-19(22)13-16-9-11-18(12-10-16)17-7-5-4-6-8-17/h4-12,19H,3,13-15,22H2,1-2H3,(H,23,24) |
| InChIKey | BTFSFSGNFIMOAZ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |