C23H29NO6 — CID 77419050
ethoxycarbonyloxymethyl 4-amino-2-(hydroxymethyl)-2-methyl-5-(4-phenylphenyl)pentanoate (PubChem CID 77419050) has the molecular formula C23H29NO6 and a molecular weight of 415.49 g/mol. Its IUPAC name is ethoxycarbonyloxymethyl 4-amino-2-(hydroxymethyl)-2-methyl-5-(4-phenylphenyl)pentanoate.
| Compound Name | ethoxycarbonyloxymethyl 4-amino-2-(hydroxymethyl)-2-methyl-5-(4-phenylphenyl)pentanoate |
|---|---|
| PubChem CID | 77419050 |
| Molecular Formula | C23H29NO6 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | ethoxycarbonyloxymethyl 4-amino-2-(hydroxymethyl)-2-methyl-5-(4-phenylphenyl)pentanoate |
| SMILES | CCOC(=O)OCOC(=O)C(C)(CO)CC(N)Cc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C23H29NO6/c1-3-28-22(27)30-16-29-21(26)23(2,15-25)14-20(24)13-17-9-11-19(12-10-17)18-7-5-4-6-8-18/h4-12,20,25H,3,13-16,24H2,1-2H3 |
| InChIKey | PBIUUMUXNKXLHW-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 108.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|